C20H19BrClNO3S2 — CID 126149103
(5R)-5-[[4-[(4-bromophenyl)methoxy]-3-chlorophenyl]methyl]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126149103) has the molecular formula C20H19BrClNO3S2 and a molecular weight of 500.87 g/mol. Its IUPAC name is (5R)-5-[[4-[(4-bromophenyl)methoxy]-3-chlorophenyl]methyl]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5R)-5-[[4-[(4-bromophenyl)methoxy]-3-chlorophenyl]methyl]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126149103 |
| Molecular Formula | C20H19BrClNO3S2 |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 498.97 |
| IUPAC Name | (5R)-5-[[4-[(4-bromophenyl)methoxy]-3-chlorophenyl]methyl]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COCCN1C(=O)[C@@H](Cc2ccc(OCc3ccc(Br)cc3)c(Cl)c2)SC1=S |
| InChI | InChI=1S/C20H19BrClNO3S2/c1-25-9-8-23-19(24)18(28-20(23)27)11-14-4-7-17(16(22)10-14)26-12-13-2-5-15(21)6-3-13/h2-7,10,18H,8-9,11-12H2,1H3/t18-/m1/s1 |
| InChIKey | CLSPODSXLQSTIN-GOSISDBHSA-N |
| XLogP | 5.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|