C20H18Cl2FNO3S2 — CID 126152090
(5R)-5-[[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126152090) has the molecular formula C20H18Cl2FNO3S2 and a molecular weight of 474.41 g/mol. Its IUPAC name is (5R)-5-[[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5R)-5-[[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126152090 |
| Molecular Formula | C20H18Cl2FNO3S2 |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | (5R)-5-[[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COCCN1C(=O)[C@@H](Cc2cc(Cl)c(OCc3cccc(F)c3)c(Cl)c2)SC1=S |
| InChI | InChI=1S/C20H18Cl2FNO3S2/c1-26-6-5-24-19(25)17(29-20(24)28)10-13-8-15(21)18(16(22)9-13)27-11-12-3-2-4-14(23)7-12/h2-4,7-9,17H,5-6,10-11H2,1H3/t17-/m1/s1 |
| InChIKey | PTIAJUYUDVXIIS-QGZVFWFLSA-N |
| XLogP | 5.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|