C25H17Cl2FN2O2S2 — CID 126146842
2-[[2,6-dichloro-4-[[(5S)-3-[(4-fluorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126146842) has the molecular formula C25H17Cl2FN2O2S2 and a molecular weight of 531.46 g/mol. Its IUPAC name is 2-[[2,6-dichloro-4-[[(5S)-3-[(4-fluorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2,6-dichloro-4-[[(5S)-3-[(4-fluorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126146842 |
| Molecular Formula | C25H17Cl2FN2O2S2 |
| Molecular Weight | 531.46 g/mol |
| Exact Mass | 530.01 |
| IUPAC Name | 2-[[2,6-dichloro-4-[[(5S)-3-[(4-fluorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(Cl)cc(C[C@@H]2SC(=S)N(Cc3ccc(F)cc3)C2=O)cc1Cl |
| InChI | InChI=1S/C25H17Cl2FN2O2S2/c26-20-9-16(10-21(27)23(20)32-14-18-4-2-1-3-17(18)12-29)11-22-24(31)30(25(33)34-22)13-15-5-7-19(28)8-6-15/h1-10,22H,11,13-14H2/t22-/m0/s1 |
| InChIKey | IXTWDBJSJSTFBQ-QFIPXVFZSA-N |
| XLogP | 6.55 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.46 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|