C21H18ClNO9 — CID 126153007
5-[(3aR,4S,7R,7aS)-4-(diacetyloxymethyl)-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-chlorobenzoic acid (PubChem CID 126153007) has the molecular formula C21H18ClNO9 and a molecular weight of 463.83 g/mol. Its IUPAC name is 5-[(3aR,4S,7R,7aS)-4-(diacetyloxymethyl)-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-chlorobenzoic acid.
| Compound Name | 5-[(3aR,4S,7R,7aS)-4-(diacetyloxymethyl)-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 126153007 |
| Molecular Formula | C21H18ClNO9 |
| Molecular Weight | 463.83 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 5-[(3aR,4S,7R,7aS)-4-(diacetyloxymethyl)-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-chlorobenzoic acid |
| SMILES | CC(=O)OC(OC(C)=O)[C@@]12C=C[C@@](C)(O1)[C@H]1C(=O)N(c3ccc(Cl)c(C(=O)O)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C21H18ClNO9/c1-9(24)30-19(31-10(2)25)21-7-6-20(3,32-21)14-15(21)17(27)23(16(14)26)11-4-5-13(22)12(8-11)18(28)29/h4-8,14-15,19H,1-3H3,(H,28,29)/t14-,15+,20-,21+/m1/s1 |
| InChIKey | VVVJAXYTLBAZKW-CALQCPNCSA-N |
| XLogP | 1.69 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.83 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|