C21H12Cl2FN3O3S — CID 126156726
(5E)-5-[[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylidene]-3-[(2-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126156726) has the molecular formula C21H12Cl2FN3O3S and a molecular weight of 476.32 g/mol. Its IUPAC name is (5E)-5-[[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylidene]-3-[(2-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylidene]-3-[(2-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126156726 |
| Molecular Formula | C21H12Cl2FN3O3S |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 475.00 |
| IUPAC Name | (5E)-5-[[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylidene]-3-[(2-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2cccc(Oc3nc(Cl)ncc3F)c2)C(=O)N1Cc1ccccc1Cl |
| InChI | InChI=1S/C21H12Cl2FN3O3S/c22-15-7-2-1-5-13(15)11-27-19(28)17(31-21(27)29)9-12-4-3-6-14(8-12)30-18-16(24)10-25-20(23)26-18/h1-10H,11H2/b17-9+ |
| InChIKey | CDVKDCJOFXUWHP-RQZCQDPDSA-N |
| XLogP | 5.95 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|