C22H14BrCl2FN4O2S — CID 126071934
(5Z)-2-(4-bromo-3-chlorophenyl)imino-5-[[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylidene]-3-ethyl-1,3-thiazolidin-4-one (PubChem CID 126071934) has the molecular formula C22H14BrCl2FN4O2S and a molecular weight of 568.26 g/mol. Its IUPAC name is (5Z)-2-(4-bromo-3-chlorophenyl)imino-5-[[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylidene]-3-ethyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-bromo-3-chlorophenyl)imino-5-[[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylidene]-3-ethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126071934 |
| Molecular Formula | C22H14BrCl2FN4O2S |
| Molecular Weight | 568.26 g/mol |
| Exact Mass | 565.94 |
| IUPAC Name | (5Z)-2-(4-bromo-3-chlorophenyl)imino-5-[[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylidene]-3-ethyl-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2cccc(Oc3nc(Cl)ncc3F)c2)S/C1=N/c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C22H14BrCl2FN4O2S/c1-2-30-20(31)18(33-22(30)28-13-6-7-15(23)16(24)10-13)9-12-4-3-5-14(8-12)32-19-17(26)11-27-21(25)29-19/h3-11H,2H2,1H3/b18-9-,28-22+ |
| InChIKey | TWUXWVHIRPWGDE-MUBOKUAQSA-N |
| XLogP | 7.10 |
| TPSA | 67.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.26 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|