C21H11Cl3FN3O3S — CID 126171898
(5E)-5-[[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126171898) has the molecular formula C21H11Cl3FN3O3S and a molecular weight of 510.76 g/mol. Its IUPAC name is (5E)-5-[[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126171898 |
| Molecular Formula | C21H11Cl3FN3O3S |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 508.96 |
| IUPAC Name | (5E)-5-[[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2cccc(Oc3nc(Cl)ncc3F)c2)C(=O)N1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H11Cl3FN3O3S/c22-13-5-4-12(15(23)8-13)10-28-19(29)17(32-21(28)30)7-11-2-1-3-14(6-11)31-18-16(25)9-26-20(24)27-18/h1-9H,10H2/b17-7+ |
| InChIKey | AFJKFZNIJYWSCR-REZTVBANSA-N |
| XLogP | 6.60 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|