C20H16ClN7O3S2 — CID 126160889
2-[[4-amino-5-(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 126160889) has the molecular formula C20H16ClN7O3S2 and a molecular weight of 501.98 g/mol. Its IUPAC name is 2-[[4-amino-5-(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[[4-amino-5-(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 126160889 |
| Molecular Formula | C20H16ClN7O3S2 |
| Molecular Weight | 501.98 g/mol |
| Exact Mass | 501.04 |
| IUPAC Name | 2-[[4-amino-5-(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CSc3nnc(-c4ccc(Cl)cc4)n3N)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16ClN7O3S2/c1-11-2-3-13(8-16(11)28(30)31)15-9-32-19(23-15)24-17(29)10-33-20-26-25-18(27(20)22)12-4-6-14(21)7-5-12/h2-9H,10,22H2,1H3,(H,23,24,29) |
| InChIKey | KNAPYVPWCVXUMJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 141.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.98 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|