C20H19BrClNO — CID 126162571
(3aS,4R,9bR)-4-(5-bromo-2-methoxyphenyl)-8-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126162571) has the molecular formula C20H19BrClNO and a molecular weight of 404.74 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-(5-bromo-2-methoxyphenyl)-8-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-4-(5-bromo-2-methoxyphenyl)-8-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126162571 |
| Molecular Formula | C20H19BrClNO |
| Molecular Weight | 404.74 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | (3aS,4R,9bR)-4-(5-bromo-2-methoxyphenyl)-8-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1ccc(Br)cc1[C@@H]1Nc2c(C)cc(Cl)cc2[C@@H]2C=CC[C@@H]21 |
| InChI | InChI=1S/C20H19BrClNO/c1-11-8-13(22)10-16-14-4-3-5-15(14)20(23-19(11)16)17-9-12(21)6-7-18(17)24-2/h3-4,6-10,14-15,20,23H,5H2,1-2H3/t14-,15+,20-/m1/s1 |
| InChIKey | RSKCYQDLZYNWOI-QEEYODRMSA-N |
| XLogP | 6.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.74 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|