C19H22INO4S — CID 126168433
(5S)-3-butyl-5-[(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126168433) has the molecular formula C19H22INO4S and a molecular weight of 487.36 g/mol. Its IUPAC name is (5S)-3-butyl-5-[(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5S)-3-butyl-5-[(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126168433 |
| Molecular Formula | C19H22INO4S |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | (5S)-3-butyl-5-[(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCOc1c(I)cc(C[C@@H]2SC(=O)N(CCCC)C2=O)cc1OCC |
| InChI | InChI=1S/C19H22INO4S/c1-4-7-8-21-18(22)16(26-19(21)23)12-13-10-14(20)17(25-9-5-2)15(11-13)24-6-3/h2,10-11,16H,4,6-9,12H2,1,3H3/t16-/m0/s1 |
| InChIKey | SALZMIVFBMCIBX-INIZCTEOSA-N |
| XLogP | 4.11 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|