C22H20I2N2O5S — CID 126169335
2-[(5E)-5-[(2-ethoxy-3,5-diiodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 126169335) has the molecular formula C22H20I2N2O5S and a molecular weight of 678.29 g/mol. Its IUPAC name is 2-[(5E)-5-[(2-ethoxy-3,5-diiodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(2-ethoxy-3,5-diiodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126169335 |
| Molecular Formula | C22H20I2N2O5S |
| Molecular Weight | 678.29 g/mol |
| Exact Mass | 677.92 |
| IUPAC Name | 2-[(5E)-5-[(2-ethoxy-3,5-diiodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(I)cc(I)c3OCC)C2=O)cc1 |
| InChI | InChI=1S/C22H20I2N2O5S/c1-3-30-16-7-5-15(6-8-16)25-19(27)12-26-21(28)18(32-22(26)29)10-13-9-14(23)11-17(24)20(13)31-4-2/h5-11H,3-4,12H2,1-2H3,(H,25,27)/b18-10+ |
| InChIKey | LFTLTXRIUIYAJA-VCHYOVAHSA-N |
| XLogP | 5.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.29 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|