C18H18I2N2O4S — CID 124643511
(5E)-5-[(2-ethoxy-3,5-diiodophenyl)methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 124643511) has the molecular formula C18H18I2N2O4S and a molecular weight of 612.23 g/mol. Its IUPAC name is (5E)-5-[(2-ethoxy-3,5-diiodophenyl)methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-ethoxy-3,5-diiodophenyl)methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124643511 |
| Molecular Formula | C18H18I2N2O4S |
| Molecular Weight | 612.23 g/mol |
| Exact Mass | 611.91 |
| IUPAC Name | (5E)-5-[(2-ethoxy-3,5-diiodophenyl)methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1c(I)cc(I)cc1/C=C1/SC(=O)N(CC(=O)N2CCCC2)C1=O |
| InChI | InChI=1S/C18H18I2N2O4S/c1-2-26-16-11(7-12(19)9-13(16)20)8-14-17(24)22(18(25)27-14)10-15(23)21-5-3-4-6-21/h7-9H,2-6,10H2,1H3/b14-8+ |
| InChIKey | QMWUBGSWTPKBRA-RIYZIHGNSA-N |
| XLogP | 3.95 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|