C29H40N4O2 — CID 126189667
N-[(4-tert-butylcyclohexylidene)amino]-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzamide (PubChem CID 126189667) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is N-[(4-tert-butylcyclohexylidene)amino]-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzamide.
| Compound Name | N-[(4-tert-butylcyclohexylidene)amino]-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 126189667 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | N-[(4-tert-butylcyclohexylidene)amino]-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzamide |
| SMILES | COc1ccccc1N1CCN(Cc2ccc(C(=O)NN=C3CCC(C(C)(C)C)CC3)cc2)CC1 |
| InChI | InChI=1S/C29H40N4O2/c1-29(2,3)24-13-15-25(16-14-24)30-31-28(34)23-11-9-22(10-12-23)21-32-17-19-33(20-18-32)26-7-5-6-8-27(26)35-4/h5-12,24H,13-21H2,1-4H3,(H,31,34)/b30-25- |
| InChIKey | BYHFXQAZVUBLFG-JVCXMKTPSA-N |
| XLogP | 5.34 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|