C15H13FN4O2 — CID 126191968
N'-[(Z)-(2-fluorophenyl)methylideneamino]-N-(pyridin-4-ylmethyl)oxamide (PubChem CID 126191968) has the molecular formula C15H13FN4O2 and a molecular weight of 300.29 g/mol. Its IUPAC name is N'-[(Z)-(2-fluorophenyl)methylideneamino]-N-(pyridin-4-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-(2-fluorophenyl)methylideneamino]-N-(pyridin-4-ylmethyl)oxamide |
|---|---|
| PubChem CID | 126191968 |
| Molecular Formula | C15H13FN4O2 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N'-[(Z)-(2-fluorophenyl)methylideneamino]-N-(pyridin-4-ylmethyl)oxamide |
| SMILES | O=C(NCc1ccncc1)C(=O)N/N=C\c1ccccc1F |
| InChI | InChI=1S/C15H13FN4O2/c16-13-4-2-1-3-12(13)10-19-20-15(22)14(21)18-9-11-5-7-17-8-6-11/h1-8,10H,9H2,(H,18,21)(H,20,22)/b19-10- |
| InChIKey | OYSIVQAHNKZOCP-GRSHGNNSSA-N |
| XLogP | 0.99 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|