C24H16N2O4S2 — CID 126194939
4-[(5E)-4,6-dioxo-5-[(4-phenylsulfanylphenyl)methylidene]-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 126194939) has the molecular formula C24H16N2O4S2 and a molecular weight of 460.54 g/mol. Its IUPAC name is 4-[(5E)-4,6-dioxo-5-[(4-phenylsulfanylphenyl)methylidene]-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 4-[(5E)-4,6-dioxo-5-[(4-phenylsulfanylphenyl)methylidene]-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 126194939 |
| Molecular Formula | C24H16N2O4S2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 4-[(5E)-4,6-dioxo-5-[(4-phenylsulfanylphenyl)methylidene]-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | O=C1NC(=S)N(c2ccc(C(=O)O)cc2)C(=O)/C1=C/c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C24H16N2O4S2/c27-21-20(14-15-6-12-19(13-7-15)32-18-4-2-1-3-5-18)22(28)26(24(31)25-21)17-10-8-16(9-11-17)23(29)30/h1-14H,(H,29,30)(H,25,27,31)/b20-14+ |
| InChIKey | KARNFQXBNXZWEF-XSFVSMFZSA-N |
| XLogP | 4.37 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|