C18H20N2O4S — CID 126197548
2-[4-(benzylsulfamoyl)phenoxy]-N-cyclopropylacetamide (PubChem CID 126197548) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-[4-(benzylsulfamoyl)phenoxy]-N-cyclopropylacetamide.
| Compound Name | 2-[4-(benzylsulfamoyl)phenoxy]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 126197548 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-[4-(benzylsulfamoyl)phenoxy]-N-cyclopropylacetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)NCc2ccccc2)cc1)NC1CC1 |
| InChI | InChI=1S/C18H20N2O4S/c21-18(20-15-6-7-15)13-24-16-8-10-17(11-9-16)25(22,23)19-12-14-4-2-1-3-5-14/h1-5,8-11,15,19H,6-7,12-13H2,(H,20,21) |
| InChIKey | VISVVJPXEYWVLJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |