C17H24N2O6S — CID 122068703
4-[[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]sulfonylamino]-4-methylpentanoic acid (PubChem CID 122068703) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is 4-[[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 4-[[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122068703 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-[[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]sulfonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NS(=O)(=O)c1ccc(OCC(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C17H24N2O6S/c1-17(2,10-9-16(21)22)19-26(23,24)14-7-5-13(6-8-14)25-11-15(20)18-12-3-4-12/h5-8,12,19H,3-4,9-11H2,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | YVRUIBNLZJTAMX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |