C16H18FN3O2 — CID 126200336
(5E)-5-[(2-fluoro-4-piperidin-1-ylphenyl)methylidene]-3-methylimidazolidine-2,4-dione (PubChem CID 126200336) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is (5E)-5-[(2-fluoro-4-piperidin-1-ylphenyl)methylidene]-3-methylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-fluoro-4-piperidin-1-ylphenyl)methylidene]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126200336 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (5E)-5-[(2-fluoro-4-piperidin-1-ylphenyl)methylidene]-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N/C(=C/c2ccc(N3CCCCC3)cc2F)C1=O |
| InChI | InChI=1S/C16H18FN3O2/c1-19-15(21)14(18-16(19)22)9-11-5-6-12(10-13(11)17)20-7-3-2-4-8-20/h5-6,9-10H,2-4,7-8H2,1H3,(H,18,22)/b14-9+ |
| InChIKey | OAQNEBKEZIKOCB-NTEUORMPSA-N |
| XLogP | 2.34 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|