C21H19FN4O3 — CID 126401054
(5E)-5-[(2-fluoro-4-piperidin-1-ylphenyl)methylidene]-1-pyridin-4-yl-1,3-diazinane-2,4,6-trione (PubChem CID 126401054) has the molecular formula C21H19FN4O3 and a molecular weight of 394.41 g/mol. Its IUPAC name is (5E)-5-[(2-fluoro-4-piperidin-1-ylphenyl)methylidene]-1-pyridin-4-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(2-fluoro-4-piperidin-1-ylphenyl)methylidene]-1-pyridin-4-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126401054 |
| Molecular Formula | C21H19FN4O3 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (5E)-5-[(2-fluoro-4-piperidin-1-ylphenyl)methylidene]-1-pyridin-4-yl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccncc2)C(=O)/C1=C/c1ccc(N2CCCCC2)cc1F |
| InChI | InChI=1S/C21H19FN4O3/c22-18-13-16(25-10-2-1-3-11-25)5-4-14(18)12-17-19(27)24-21(29)26(20(17)28)15-6-8-23-9-7-15/h4-9,12-13H,1-3,10-11H2,(H,24,27,29)/b17-12+ |
| InChIKey | YTCSXOYJKQUTRG-SFQUDFHCSA-N |
| XLogP | 2.88 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|