C23H25N3O2 — CID 126258499
(5E)-3-benzyl-5-[(2-methyl-4-piperidin-1-ylphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 126258499) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[(2-methyl-4-piperidin-1-ylphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-benzyl-5-[(2-methyl-4-piperidin-1-ylphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126258499 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (5E)-3-benzyl-5-[(2-methyl-4-piperidin-1-ylphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | Cc1cc(N2CCCCC2)ccc1/C=C1/NC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C23H25N3O2/c1-17-14-20(25-12-6-3-7-13-25)11-10-19(17)15-21-22(27)26(23(28)24-21)16-18-8-4-2-5-9-18/h2,4-5,8-11,14-15H,3,6-7,12-13,16H2,1H3,(H,24,28)/b21-15+ |
| InChIKey | XGRVWJPHBRESGQ-RCCKNPSSSA-N |
| XLogP | 4.08 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|