C24H28ClN3O3 — CID 139705073
5-[[3-(azepan-1-ylmethyl)-2-hydroxyphenyl]methylidene]-3-benzylimidazolidine-2,4-dione;hydrochloride (PubChem CID 139705073) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is 5-[[3-(azepan-1-ylmethyl)-2-hydroxyphenyl]methylidene]-3-benzylimidazolidine-2,4-dione;hydrochloride.
| Compound Name | 5-[[3-(azepan-1-ylmethyl)-2-hydroxyphenyl]methylidene]-3-benzylimidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 139705073 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 5-[[3-(azepan-1-ylmethyl)-2-hydroxyphenyl]methylidene]-3-benzylimidazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1NC(=Cc2cccc(CN3CCCCCC3)c2O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H27N3O3.ClH/c28-22-19(11-8-12-20(22)17-26-13-6-1-2-7-14-26)15-21-23(29)27(24(30)25-21)16-18-9-4-3-5-10-18;/h3-5,8-12,15,28H,1-2,6-7,13-14,16-17H2,(H,25,30);1H |
| InChIKey | FZAYTNICJJUNCM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|