C21H15ClO2 — CID 126202988
1-(2-chloro-4-methylphenyl)-2-(2-phenylphenyl)ethane-1,2-dione (PubChem CID 126202988) has the molecular formula C21H15ClO2 and a molecular weight of 334.80 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-2-(2-phenylphenyl)ethane-1,2-dione.
| Compound Name | 1-(2-chloro-4-methylphenyl)-2-(2-phenylphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 126202988 |
| Molecular Formula | C21H15ClO2 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-2-(2-phenylphenyl)ethane-1,2-dione |
| SMILES | Cc1ccc(C(=O)C(=O)c2ccccc2-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C21H15ClO2/c1-14-11-12-18(19(22)13-14)21(24)20(23)17-10-6-5-9-16(17)15-7-3-2-4-8-15/h2-13H,1H3 |
| InChIKey | XMSBJOJTJSYUNL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|