C21H19NO6S2 — CID 126206931
2-[2-ethoxy-6-[(Z)-[3-(2-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126206931) has the molecular formula C21H19NO6S2 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-[2-ethoxy-6-[(Z)-[3-(2-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-6-[(Z)-[3-(2-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126206931 |
| Molecular Formula | C21H19NO6S2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 2-[2-ethoxy-6-[(Z)-[3-(2-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOc1cccc(/C=C2\SC(=S)N(c3ccccc3OC)C2=O)c1OCC(=O)O |
| InChI | InChI=1S/C21H19NO6S2/c1-3-27-16-10-6-7-13(19(16)28-12-18(23)24)11-17-20(25)22(21(29)30-17)14-8-4-5-9-15(14)26-2/h4-11H,3,12H2,1-2H3,(H,23,24)/b17-11- |
| InChIKey | IRFDIKHHMWDFHF-BOPFTXTBSA-N |
| XLogP | 3.96 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|