C22H21NO5S2 — CID 126206056
2-[2-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetic acid (PubChem CID 126206056) has the molecular formula C22H21NO5S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-[2-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126206056 |
| Molecular Formula | C22H21NO5S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 2-[2-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cccc(/C=C2/SC(=S)N(c3ccc(C)cc3C)C2=O)c1OCC(=O)O |
| InChI | InChI=1S/C22H21NO5S2/c1-4-27-17-7-5-6-15(20(17)28-12-19(24)25)11-18-21(26)23(22(29)30-18)16-9-8-13(2)10-14(16)3/h5-11H,4,12H2,1-3H3,(H,24,25)/b18-11+ |
| InChIKey | FALGRAQCEURYJE-WOJGMQOQSA-N |
| XLogP | 4.57 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|