C22H21NO5S2 — CID 2298473
ethyl 2-[2-methoxy-6-[(E)-[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 2298473) has the molecular formula C22H21NO5S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is ethyl 2-[2-methoxy-6-[(E)-[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-methoxy-6-[(E)-[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2298473 |
| Molecular Formula | C22H21NO5S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | ethyl 2-[2-methoxy-6-[(E)-[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(/C=C2/SC(=S)N(c3ccccc3C)C2=O)cccc1OC |
| InChI | InChI=1S/C22H21NO5S2/c1-4-27-19(24)13-28-20-15(9-7-11-17(20)26-3)12-18-21(25)23(22(29)30-18)16-10-6-5-8-14(16)2/h5-12H,4,13H2,1-3H3/b18-12+ |
| InChIKey | CFDBYWWFZFLLHE-LDADJPATSA-N |
| XLogP | 4.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|