C21H18FNO5S2 — CID 2297159
ethyl 2-[2-[(E)-[3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate (PubChem CID 2297159) has the molecular formula C21H18FNO5S2 and a molecular weight of 447.51 g/mol. Its IUPAC name is ethyl 2-[2-[(E)-[3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-[(E)-[3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 2297159 |
| Molecular Formula | C21H18FNO5S2 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | ethyl 2-[2-[(E)-[3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(/C=C2/SC(=S)N(c3ccc(F)cc3)C2=O)cccc1OC |
| InChI | InChI=1S/C21H18FNO5S2/c1-3-27-18(24)12-28-19-13(5-4-6-16(19)26-2)11-17-20(25)23(21(29)30-17)15-9-7-14(22)8-10-15/h4-11H,3,12H2,1-2H3/b17-11+ |
| InChIKey | CTBLSTJIIGQJJA-GZTJUZNOSA-N |
| XLogP | 4.18 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|