C29H28N2O5S — CID 26366225
2-[2-[(Z)-[3-(2,5-dimethylphenyl)-2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 26366225) has the molecular formula C29H28N2O5S and a molecular weight of 516.62 g/mol. Its IUPAC name is 2-[2-[(Z)-[3-(2,5-dimethylphenyl)-2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[(Z)-[3-(2,5-dimethylphenyl)-2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 26366225 |
| Molecular Formula | C29H28N2O5S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 2-[2-[(Z)-[3-(2,5-dimethylphenyl)-2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cccc(/C=C2\S/C(=N\c3cc(C)ccc3C)N(c3cc(C)ccc3C)C2=O)c1OCC(=O)O |
| InChI | InChI=1S/C29H28N2O5S/c1-17-9-11-19(3)22(13-17)30-29-31(23-14-18(2)10-12-20(23)4)28(34)25(37-29)15-21-7-6-8-24(35-5)27(21)36-16-26(32)33/h6-15H,16H2,1-5H3,(H,32,33)/b25-15-,30-29- |
| InChIKey | XQPBBSATUVXBDZ-LAFZTMSTSA-N |
| XLogP | 6.20 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|