C20H18ClN3O3S — CID 126207301
2-chloro-5-[2,5-dimethyl-3-[(Z)-[(2-thiophen-2-ylacetyl)hydrazinylidene]methyl]pyrrol-1-yl]benzoic acid (PubChem CID 126207301) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is 2-chloro-5-[2,5-dimethyl-3-[(Z)-[(2-thiophen-2-ylacetyl)hydrazinylidene]methyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[2,5-dimethyl-3-[(Z)-[(2-thiophen-2-ylacetyl)hydrazinylidene]methyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 126207301 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 2-chloro-5-[2,5-dimethyl-3-[(Z)-[(2-thiophen-2-ylacetyl)hydrazinylidene]methyl]pyrrol-1-yl]benzoic acid |
| SMILES | Cc1cc(/C=N\NC(=O)Cc2cccs2)c(C)n1-c1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H18ClN3O3S/c1-12-8-14(11-22-23-19(25)10-16-4-3-7-28-16)13(2)24(12)15-5-6-18(21)17(9-15)20(26)27/h3-9,11H,10H2,1-2H3,(H,23,25)(H,26,27)/b22-11- |
| InChIKey | UZIGEGDJCFZHDS-JJFYIABZSA-N |
| XLogP | 4.20 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|