C23H22ClNO — CID 126208451
1-[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]-N-(2,3-dimethylphenyl)methanimine (PubChem CID 126208451) has the molecular formula C23H22ClNO and a molecular weight of 363.89 g/mol. Its IUPAC name is 1-[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]-N-(2,3-dimethylphenyl)methanimine.
| Compound Name | 1-[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]-N-(2,3-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126208451 |
| Molecular Formula | C23H22ClNO |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 1-[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]-N-(2,3-dimethylphenyl)methanimine |
| SMILES | Cc1ccc(COc2ccc(Cl)cc2/C=N/c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C23H22ClNO/c1-16-7-9-19(10-8-16)15-26-23-12-11-21(24)13-20(23)14-25-22-6-4-5-17(2)18(22)3/h4-14H,15H2,1-3H3/b25-14+ |
| InChIKey | QMUIGPFVGYWCAB-AFUMVMLFSA-N |
| XLogP | 6.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|