C25H20BrN3O5 — CID 126214113
2-[5-bromo-4-[(E)-2-cyano-2-(4-nitrophenyl)ethenyl]-2-ethoxyphenoxy]-N-phenylacetamide (PubChem CID 126214113) has the molecular formula C25H20BrN3O5 and a molecular weight of 522.36 g/mol. Its IUPAC name is 2-[5-bromo-4-[(E)-2-cyano-2-(4-nitrophenyl)ethenyl]-2-ethoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[5-bromo-4-[(E)-2-cyano-2-(4-nitrophenyl)ethenyl]-2-ethoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126214113 |
| Molecular Formula | C25H20BrN3O5 |
| Molecular Weight | 522.36 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 2-[5-bromo-4-[(E)-2-cyano-2-(4-nitrophenyl)ethenyl]-2-ethoxyphenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(/C=C(/C#N)c2ccc([N+](=O)[O-])cc2)c(Br)cc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H20BrN3O5/c1-2-33-23-13-18(12-19(15-27)17-8-10-21(11-9-17)29(31)32)22(26)14-24(23)34-16-25(30)28-20-6-4-3-5-7-20/h3-14H,2,16H2,1H3,(H,28,30)/b19-12- |
| InChIKey | CHUWXFIAMKHKOQ-UNOMPAQXSA-N |
| XLogP | 5.84 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.36 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|