C21H26N2O7S — CID 126216587
(5Z)-5-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126216587) has the molecular formula C21H26N2O7S and a molecular weight of 450.51 g/mol. Its IUPAC name is (5Z)-5-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126216587 |
| Molecular Formula | C21H26N2O7S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | (5Z)-5-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CCOC)C2=O)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H26N2O7S/c1-3-29-17-12-15(13-18-20(25)23(8-9-27-2)21(26)31-18)4-5-16(17)30-14-19(24)22-6-10-28-11-7-22/h4-5,12-13H,3,6-11,14H2,1-2H3/b18-13- |
| InChIKey | KSCKNGFTPKKJIR-AQTBWJFISA-N |
| XLogP | 2.01 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|