C23H23FN2O4S — CID 126220368
N-butyl-2-[(5Z)-5-[[4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126220368) has the molecular formula C23H23FN2O4S and a molecular weight of 442.51 g/mol. Its IUPAC name is N-butyl-2-[(5Z)-5-[[4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-butyl-2-[(5Z)-5-[[4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126220368 |
| Molecular Formula | C23H23FN2O4S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | N-butyl-2-[(5Z)-5-[[4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCCCNC(=O)CN1C(=O)S/C(=C\c2ccc(OCc3cccc(F)c3)cc2)C1=O |
| InChI | InChI=1S/C23H23FN2O4S/c1-2-3-11-25-21(27)14-26-22(28)20(31-23(26)29)13-16-7-9-19(10-8-16)30-15-17-5-4-6-18(24)12-17/h4-10,12-13H,2-3,11,14-15H2,1H3,(H,25,27)/b20-13- |
| InChIKey | WBLWSDKZGXELNV-MOSHPQCFSA-N |
| XLogP | 4.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|