C22H20FNO5S — CID 126103210
propan-2-yl 2-[(5E)-5-[[4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126103210) has the molecular formula C22H20FNO5S and a molecular weight of 429.47 g/mol. Its IUPAC name is propan-2-yl 2-[(5E)-5-[[4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(5E)-5-[[4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126103210 |
| Molecular Formula | C22H20FNO5S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | propan-2-yl 2-[(5E)-5-[[4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)OC(=O)CN1C(=O)S/C(=C/c2ccc(OCc3cccc(F)c3)cc2)C1=O |
| InChI | InChI=1S/C22H20FNO5S/c1-14(2)29-20(25)12-24-21(26)19(30-22(24)27)11-15-6-8-18(9-7-15)28-13-16-4-3-5-17(23)10-16/h3-11,14H,12-13H2,1-2H3/b19-11+ |
| InChIKey | KVLIEWRULPKNIR-YBFXNURJSA-N |
| XLogP | 4.39 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|