C26H23NO5S — CID 124642137
propan-2-yl 2-[(5E)-5-[[4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 124642137) has the molecular formula C26H23NO5S and a molecular weight of 461.54 g/mol. Its IUPAC name is propan-2-yl 2-[(5E)-5-[[4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(5E)-5-[[4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 124642137 |
| Molecular Formula | C26H23NO5S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | propan-2-yl 2-[(5E)-5-[[4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)OC(=O)CN1C(=O)S/C(=C/c2ccc(OCc3cccc4ccccc34)cc2)C1=O |
| InChI | InChI=1S/C26H23NO5S/c1-17(2)32-24(28)15-27-25(29)23(33-26(27)30)14-18-10-12-21(13-11-18)31-16-20-8-5-7-19-6-3-4-9-22(19)20/h3-14,17H,15-16H2,1-2H3/b23-14+ |
| InChIKey | XTBBZBPWBAQCIM-OEAKJJBVSA-N |
| XLogP | 5.41 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|