C31H31N3O2 — CID 126220818
(E)-3-[1-[4-(1-adamantyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 126220818) has the molecular formula C31H31N3O2 and a molecular weight of 477.61 g/mol. Its IUPAC name is (E)-3-[1-[4-(1-adamantyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[1-[4-(1-adamantyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126220818 |
| Molecular Formula | C31H31N3O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | (E)-3-[1-[4-(1-adamantyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(/C#N)c2ccc([N+](=O)[O-])cc2)c(C)n1-c1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C31H31N3O2/c1-20-11-26(15-27(19-32)25-3-7-30(8-4-25)34(35)36)21(2)33(20)29-9-5-28(6-10-29)31-16-22-12-23(17-31)14-24(13-22)18-31/h3-11,15,22-24H,12-14,16-18H2,1-2H3/b27-15- |
| InChIKey | WKZPQLZQFGWXMO-DICXZTSXSA-N |
| XLogP | 7.53 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|