C18H11BrN2O5S — CID 126223451
(5E)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[(2-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126223451) has the molecular formula C18H11BrN2O5S and a molecular weight of 447.27 g/mol. Its IUPAC name is (5E)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[(2-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[(2-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126223451 |
| Molecular Formula | C18H11BrN2O5S |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 445.96 |
| IUPAC Name | (5E)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[(2-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccccc2[N+](=O)[O-])C1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H11BrN2O5S/c19-13-7-5-11(6-8-13)15(22)10-20-17(23)16(27-18(20)24)9-12-3-1-2-4-14(12)21(25)26/h1-9H,10H2/b16-9+ |
| InChIKey | AQNPLKRJAABZFO-CXUHLZMHSA-N |
| XLogP | 4.28 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|