C18H9Cl2N3O7S — CID 126361803
(5Z)-5-[(2,4-dichloro-5-nitrophenyl)methylidene]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126361803) has the molecular formula C18H9Cl2N3O7S and a molecular weight of 482.26 g/mol. Its IUPAC name is (5Z)-5-[(2,4-dichloro-5-nitrophenyl)methylidene]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2,4-dichloro-5-nitrophenyl)methylidene]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126361803 |
| Molecular Formula | C18H9Cl2N3O7S |
| Molecular Weight | 482.26 g/mol |
| Exact Mass | 480.95 |
| IUPAC Name | (5Z)-5-[(2,4-dichloro-5-nitrophenyl)methylidene]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cc([N+](=O)[O-])c(Cl)cc2Cl)C1=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H9Cl2N3O7S/c19-12-7-13(20)14(23(29)30)5-10(12)6-16-17(25)21(18(26)31-16)8-15(24)9-1-3-11(4-2-9)22(27)28/h1-7H,8H2/b16-6- |
| InChIKey | HAIZLODQCGKYSZ-SOFYXZRVSA-N |
| XLogP | 4.73 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|