C22H17BrClN3O5 — CID 126224623
2-[2-bromo-6-methoxy-4-[(4-nitrophenyl)iminomethyl]phenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 126224623) has the molecular formula C22H17BrClN3O5 and a molecular weight of 518.75 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[(4-nitrophenyl)iminomethyl]phenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[2-bromo-6-methoxy-4-[(4-nitrophenyl)iminomethyl]phenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126224623 |
| Molecular Formula | C22H17BrClN3O5 |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 517.00 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[(4-nitrophenyl)iminomethyl]phenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | COc1cc(/C=N/c2ccc([N+](=O)[O-])cc2)cc(Br)c1OCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H17BrClN3O5/c1-31-20-11-14(12-25-16-6-8-18(9-7-16)27(29)30)10-19(23)22(20)32-13-21(28)26-17-4-2-15(24)3-5-17/h2-12H,13H2,1H3,(H,26,28)/b25-12+ |
| InChIKey | FFTIEYPMWBUBJT-BRJLIKDPSA-N |
| XLogP | 5.79 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|