C27H26N4O6 — CID 126230280
methyl 3-[3-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 126230280) has the molecular formula C27H26N4O6 and a molecular weight of 502.53 g/mol. Its IUPAC name is methyl 3-[3-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 3-[3-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 126230280 |
| Molecular Formula | C27H26N4O6 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | methyl 3-[3-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(-n2c(C)cc(/C=C3/NC(=O)N(CC(=O)Nc4ccccc4OC)C3=O)c2C)c1 |
| InChI | InChI=1S/C27H26N4O6/c1-16-12-19(17(2)31(16)20-9-7-8-18(13-20)26(34)37-4)14-22-25(33)30(27(35)29-22)15-24(32)28-21-10-5-6-11-23(21)36-3/h5-14H,15H2,1-4H3,(H,28,32)(H,29,35)/b22-14+ |
| InChIKey | HKDKYINPHBSZIG-HYARGMPZSA-N |
| XLogP | 3.42 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|