C20H17ClN2O4 — CID 126238418
(5E)-3-(4-chlorophenyl)-5-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 126238418) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is (5E)-3-(4-chlorophenyl)-5-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-(4-chlorophenyl)-5-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126238418 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | (5E)-3-(4-chlorophenyl)-5-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | C=CCc1cc(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)cc(OC)c1O |
| InChI | InChI=1S/C20H17ClN2O4/c1-3-4-13-9-12(11-17(27-2)18(13)24)10-16-19(25)23(20(26)22-16)15-7-5-14(21)6-8-15/h3,5-11,24H,1,4H2,2H3,(H,22,26)/b16-10+ |
| InChIKey | PEQBRQYDOUWLDI-MHWRWJLKSA-N |
| XLogP | 3.88 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|