C22H15Cl2N3O4 — CID 126238508
(Z)-2-cyano-3-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 126238508) has the molecular formula C22H15Cl2N3O4 and a molecular weight of 456.29 g/mol. Its IUPAC name is (Z)-2-cyano-3-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126238508 |
| Molecular Formula | C22H15Cl2N3O4 |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | (Z)-2-cyano-3-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C(C#N)=C\c1ccc(-c2cc([N+](=O)[O-])c(Cl)cc2Cl)o1)c1ccccc1 |
| InChI | InChI=1S/C22H15Cl2N3O4/c1-13(14-5-3-2-4-6-14)26-22(28)15(12-25)9-16-7-8-21(31-16)17-10-20(27(29)30)19(24)11-18(17)23/h2-11,13H,1H3,(H,26,28)/b15-9-/t13-/m1/s1 |
| InChIKey | QBDACAYBHZRBJO-MLJKTZRHSA-N |
| XLogP | 5.95 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|