C24H20N2O4 — CID 126248797
4-[5-[(Z)-2-cyano-3-oxo-3-[[(1R)-1-phenylethyl]amino]prop-1-enyl]furan-2-yl]-3-methylbenzoic acid (PubChem CID 126248797) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is 4-[5-[(Z)-2-cyano-3-oxo-3-[[(1R)-1-phenylethyl]amino]prop-1-enyl]furan-2-yl]-3-methylbenzoic acid.
| Compound Name | 4-[5-[(Z)-2-cyano-3-oxo-3-[[(1R)-1-phenylethyl]amino]prop-1-enyl]furan-2-yl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 126248797 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 4-[5-[(Z)-2-cyano-3-oxo-3-[[(1R)-1-phenylethyl]amino]prop-1-enyl]furan-2-yl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-c1ccc(/C=C(/C#N)C(=O)N[C@H](C)c2ccccc2)o1 |
| InChI | InChI=1S/C24H20N2O4/c1-15-12-18(24(28)29)8-10-21(15)22-11-9-20(30-22)13-19(14-25)23(27)26-16(2)17-6-4-3-5-7-17/h3-13,16H,1-2H3,(H,26,27)(H,28,29)/b19-13-/t16-/m1/s1 |
| InChIKey | WZUGAWGKGAGPGF-YZYPPFLQSA-N |
| XLogP | 4.74 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|