C19H19ClN2O4 — CID 126243345
2-[4-[(4-chloro-2-hydroxyphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 126243345) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is 2-[4-[(4-chloro-2-hydroxyphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[(4-chloro-2-hydroxyphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 126243345 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-[4-[(4-chloro-2-hydroxyphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | O=C(COc1ccc(/C=N/c2ccc(Cl)cc2O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C19H19ClN2O4/c20-15-3-6-17(18(23)11-15)21-12-14-1-4-16(5-2-14)26-13-19(24)22-7-9-25-10-8-22/h1-6,11-12,23H,7-10,13H2/b21-12+ |
| InChIKey | HTDWUARWSXOOMH-CIAFOILYSA-N |
| XLogP | 3.03 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|