C26H20BrClN2O3S2 — CID 126245852
N-(4-bromo-3-methylphenyl)-2-[3-[(Z)-[3-(3-chloro-4-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126245852) has the molecular formula C26H20BrClN2O3S2 and a molecular weight of 587.95 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-[3-[(Z)-[3-(3-chloro-4-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-[3-[(Z)-[3-(3-chloro-4-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126245852 |
| Molecular Formula | C26H20BrClN2O3S2 |
| Molecular Weight | 587.95 g/mol |
| Exact Mass | 585.98 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-[3-[(Z)-[3-(3-chloro-4-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | Cc1ccc(N2C(=O)/C(=C/c3cccc(OCC(=O)Nc4ccc(Br)c(C)c4)c3)SC2=S)cc1Cl |
| InChI | InChI=1S/C26H20BrClN2O3S2/c1-15-6-8-19(13-22(15)28)30-25(32)23(35-26(30)34)12-17-4-3-5-20(11-17)33-14-24(31)29-18-7-9-21(27)16(2)10-18/h3-13H,14H2,1-2H3,(H,29,31)/b23-12- |
| InChIKey | IFAZKGWEJFEJLG-FMCGGJTJSA-N |
| XLogP | 7.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.95 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|