C24H23BrN2O4S2 — CID 126274766
N-(4-bromo-3-methylphenyl)-2-[3-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126274766) has the molecular formula C24H23BrN2O4S2 and a molecular weight of 547.50 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-[3-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-[3-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126274766 |
| Molecular Formula | C24H23BrN2O4S2 |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-[3-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | Cc1cc(NC(=O)COc2cccc(/C=C3\SC(=S)N(C[C@H]4CCCO4)C3=O)c2)ccc1Br |
| InChI | InChI=1S/C24H23BrN2O4S2/c1-15-10-17(7-8-20(15)25)26-22(28)14-31-18-5-2-4-16(11-18)12-21-23(29)27(24(32)33-21)13-19-6-3-9-30-19/h2,4-5,7-8,10-12,19H,3,6,9,13-14H2,1H3,(H,26,28)/b21-12-/t19-/m1/s1 |
| InChIKey | WJKCMEHLZMXONX-GFIJVFARSA-N |
| XLogP | 5.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|