C22H19BrN2O4S2 — CID 17201855
[4-[(E)-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] N-(4-bromophenyl)carbamate (PubChem CID 17201855) has the molecular formula C22H19BrN2O4S2 and a molecular weight of 519.44 g/mol. Its IUPAC name is [4-[(E)-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] N-(4-bromophenyl)carbamate.
| Compound Name | [4-[(E)-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 17201855 |
| Molecular Formula | C22H19BrN2O4S2 |
| Molecular Weight | 519.44 g/mol |
| Exact Mass | 518.00 |
| IUPAC Name | [4-[(E)-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] N-(4-bromophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Br)cc1)Oc1ccc(/C=C2/SC(=S)N(CC3CCCO3)C2=O)cc1 |
| InChI | InChI=1S/C22H19BrN2O4S2/c23-15-5-7-16(8-6-15)24-21(27)29-17-9-3-14(4-10-17)12-19-20(26)25(22(30)31-19)13-18-2-1-11-28-18/h3-10,12,18H,1-2,11,13H2,(H,24,27)/b19-12+ |
| InChIKey | UNECELRMGASBPQ-XDHOZWIPSA-N |
| XLogP | 5.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|