C22H18ClNO4S2 — CID 44615120
[4-[(Z)-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 44615120) has the molecular formula C22H18ClNO4S2 and a molecular weight of 459.98 g/mol. Its IUPAC name is [4-[(Z)-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-[(Z)-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 44615120 |
| Molecular Formula | C22H18ClNO4S2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | [4-[(Z)-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(Oc1ccc(/C=C2\SC(=S)N(CC3CCCO3)C2=O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClNO4S2/c23-16-7-5-15(6-8-16)21(26)28-17-9-3-14(4-10-17)12-19-20(25)24(22(29)30-19)13-18-2-1-11-27-18/h3-10,12,18H,1-2,11,13H2/b19-12- |
| InChIKey | KSCSVSNGVQMGLE-UNOMPAQXSA-N |
| XLogP | 4.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|