C23H21NO5S2 — CID 2892271
[2-methoxy-4-[[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate (PubChem CID 2892271) has the molecular formula C23H21NO5S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is [2-methoxy-4-[[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate.
| Compound Name | [2-methoxy-4-[[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 2892271 |
| Molecular Formula | C23H21NO5S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | [2-methoxy-4-[[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate |
| SMILES | COc1cc(C=C2SC(=S)N(CC3CCCO3)C2=O)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21NO5S2/c1-27-19-12-15(9-10-18(19)29-22(26)16-6-3-2-4-7-16)13-20-21(25)24(23(30)31-20)14-17-8-5-11-28-17/h2-4,6-7,9-10,12-13,17H,5,8,11,14H2,1H3 |
| InChIKey | JVTUADAEZJLDPG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|