C25H23NO5S2 — CID 2908608
[4-[[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 2908608) has the molecular formula C25H23NO5S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is [4-[[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [4-[[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2908608 |
| Molecular Formula | C25H23NO5S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | [4-[[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)Oc2ccc(C=C3SC(=S)N(CC4CCCO4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C25H23NO5S2/c1-29-19-9-4-17(5-10-19)8-13-23(27)31-20-11-6-18(7-12-20)15-22-24(28)26(25(32)33-22)16-21-3-2-14-30-21/h4-13,15,21H,2-3,14,16H2,1H3 |
| InChIKey | PPYDWJPOFVMIFX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|