C27H21FN2O7S — CID 126249595
3-[[4-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126249595) has the molecular formula C27H21FN2O7S and a molecular weight of 536.54 g/mol. Its IUPAC name is 3-[[4-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126249595 |
| Molecular Formula | C27H21FN2O7S |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | 3-[[4-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc(F)c3)C2=O)ccc1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C27H21FN2O7S/c1-36-22-11-16(8-9-21(22)37-15-17-4-2-5-18(10-17)26(33)34)12-23-25(32)30(27(35)38-23)14-24(31)29-20-7-3-6-19(28)13-20/h2-13H,14-15H2,1H3,(H,29,31)(H,33,34)/b23-12+ |
| InChIKey | WFIFOHJSSJUQMX-FSJBWODESA-N |
| XLogP | 4.79 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|